C25H29N3O5 — CID 10456471
3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione (PubChem CID 10456471) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10456471 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione |
| SMILES | COc1cc2[nH]c(=O)n(CCN3C[C@@H]4CCc5c(OC)cccc5[C@@H]4C3)c(=O)c2cc1OC |
| InChI | InChI=1S/C25H29N3O5/c1-31-21-6-4-5-16-17(21)8-7-15-13-27(14-19(15)16)9-10-28-24(29)18-11-22(32-2)23(33-3)12-20(18)26-25(28)30/h4-6,11-12,15,19H,7-10,13-14H2,1-3H3,(H,26,30)/t15-,19+/m0/s1 |
| InChIKey | IATJRNATRBECGI-HNAYVOBHSA-N |
| XLogP | 2.38 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |