C14H24N2O3 — CID 104565921
6-[2-(2-methoxyethoxy)ethoxymethyl]-N-propylpyridin-2-amine (PubChem CID 104565921) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-[2-(2-methoxyethoxy)ethoxymethyl]-N-propylpyridin-2-amine.
| Compound Name | 6-[2-(2-methoxyethoxy)ethoxymethyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 104565921 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 6-[2-(2-methoxyethoxy)ethoxymethyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(COCCOCCOC)n1 |
| InChI | InChI=1S/C14H24N2O3/c1-3-7-15-14-6-4-5-13(16-14)12-19-11-10-18-9-8-17-2/h4-6H,3,7-12H2,1-2H3,(H,15,16) |
| InChIKey | XBCJBAGDBKORRL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|