C20H36F2N2O5S — CID 10456650
(2S,4R)-4-(4,4-difluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide (PubChem CID 10456650) has the molecular formula C20H36F2N2O5S and a molecular weight of 454.58 g/mol. Its IUPAC name is (2S,4R)-4-(4,4-difluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(4,4-difluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 10456650 |
| Molecular Formula | C20H36F2N2O5S |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (2S,4R)-4-(4,4-difluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2C[C@H](CCCC(F)F)CCN2)C(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H36F2N2O5S/c1-10(2)14(18-16(26)15(25)17(27)20(29-18)30-3)24-19(28)12-9-11(7-8-23-12)5-4-6-13(21)22/h10-18,20,23,25-27H,4-9H2,1-3H3,(H,24,28)/t11-,12+,14-,15+,16-,17-,18-,20-/m1/s1 |
| InChIKey | JPGDJWQEAYQZIQ-JQTBSSTASA-N |
| XLogP | 1.10 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |