C16H35NO4 — CID 104566572
2,2-diethyl-4-[2-(2-methoxyethoxy)ethoxy]-N-(2-methoxyethyl)butan-1-amine (PubChem CID 104566572) has the molecular formula C16H35NO4 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2,2-diethyl-4-[2-(2-methoxyethoxy)ethoxy]-N-(2-methoxyethyl)butan-1-amine.
| Compound Name | 2,2-diethyl-4-[2-(2-methoxyethoxy)ethoxy]-N-(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 104566572 |
| Molecular Formula | C16H35NO4 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | 2,2-diethyl-4-[2-(2-methoxyethoxy)ethoxy]-N-(2-methoxyethyl)butan-1-amine |
| SMILES | CCC(CC)(CCOCCOCCOC)CNCCOC |
| InChI | InChI=1S/C16H35NO4/c1-5-16(6-2,15-17-8-10-18-3)7-9-20-13-14-21-12-11-19-4/h17H,5-15H2,1-4H3 |
| InChIKey | CNVTTZCNJARVDJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|