C11H21BrO3 — CID 104567999
2-bromo-4-[2-(2-methoxyethoxy)ethoxy]-1,1-dimethylcyclobutane (PubChem CID 104567999) has the molecular formula C11H21BrO3 and a molecular weight of 281.19 g/mol. Its IUPAC name is 2-bromo-4-[2-(2-methoxyethoxy)ethoxy]-1,1-dimethylcyclobutane.
| Compound Name | 2-bromo-4-[2-(2-methoxyethoxy)ethoxy]-1,1-dimethylcyclobutane |
|---|---|
| PubChem CID | 104567999 |
| Molecular Formula | C11H21BrO3 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-bromo-4-[2-(2-methoxyethoxy)ethoxy]-1,1-dimethylcyclobutane |
| SMILES | COCCOCCOC1CC(Br)C1(C)C |
| InChI | InChI=1S/C11H21BrO3/c1-11(2)9(12)8-10(11)15-7-6-14-5-4-13-3/h9-10H,4-8H2,1-3H3 |
| InChIKey | DIUXIWBNKWTAJW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|