C22H29F2NO5S — CID 10456814
7-[4-[(E)-4,4-difluoro-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid (PubChem CID 10456814) has the molecular formula C22H29F2NO5S and a molecular weight of 457.54 g/mol. Its IUPAC name is 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid.
| Compound Name | 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 10456814 |
| Molecular Formula | C22H29F2NO5S |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid |
| SMILES | COCc1cccc(C(F)(F)C(O)/C=C/C2CSC(=O)N2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C22H29F2NO5S/c1-30-14-16-7-6-8-17(13-16)22(23,24)19(26)11-10-18-15-31-21(29)25(18)12-5-3-2-4-9-20(27)28/h6-8,10-11,13,18-19,26H,2-5,9,12,14-15H2,1H3,(H,27,28)/b11-10+ |
| InChIKey | XUJGJPXQPMPXAK-ZHACJKMWSA-N |
| XLogP | 4.41 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|