C11H19NO4S — CID 104569649
2-[2-[ethyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569649) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-[2-[ethyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[ethyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569649 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[2-[ethyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CCN(CC1CCOC1)C(=O)CSCC(=O)O |
| InChI | InChI=1S/C11H19NO4S/c1-2-12(5-9-3-4-16-6-9)10(13)7-17-8-11(14)15/h9H,2-8H2,1H3,(H,14,15) |
| InChIKey | JWTSTNUXJRBFJJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |