About 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid
2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 104570234) has the molecular formula C6H9F2NO3S
and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid |
| PubChem CID | 104570234 |
| Molecular Formula | C6H9F2NO3S |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)NCC(F)F |
| InChI | InChI=1S/C6H9F2NO3S/c7-4(8)1-9-5(10)2-13-3-6(11)12/h4H,1-3H2,(H,9,10)(H,11,12) |
| InChIKey | OLJGSMICKWTCDY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid?
The IUPAC name of 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid (CID 104570234) is 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid.
What is the SMILES notation for 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid?
The canonical SMILES for 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid is O=C(O)CSCC(=O)NCC(F)F.
What is the InChIKey of 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid?
The InChIKey is OLJGSMICKWTCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2NO3S/c7-4(8)1-9-5(10)2-13-3-6(11)12/h4H,1-3H2,(H,9,10)(H,11,12).
What are the key properties of 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid?
2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid has a molecular weight of 213.20 g/mol, XLogP of 0.19, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethylamino)-2-oxoethyl]sulfanylacetic acid is sourced from PubChem (CID 104570234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).