C7H9NO5S — CID 104570476
3-(3,5-dioxothiomorpholin-4-yl)-2-hydroxypropanoic acid (PubChem CID 104570476) has the molecular formula C7H9NO5S and a molecular weight of 219.22 g/mol. Its IUPAC name is 3-(3,5-dioxothiomorpholin-4-yl)-2-hydroxypropanoic acid.
| Compound Name | 3-(3,5-dioxothiomorpholin-4-yl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 104570476 |
| Molecular Formula | C7H9NO5S |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 3-(3,5-dioxothiomorpholin-4-yl)-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(O)CN1C(=O)CSCC1=O |
| InChI | InChI=1S/C7H9NO5S/c9-4(7(12)13)1-8-5(10)2-14-3-6(8)11/h4,9H,1-3H2,(H,12,13) |
| InChIKey | BHZNHNFAVIAOSQ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|