About 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid
9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid (PubChem CID 10457147) has the molecular formula C29H20O6
and a molecular weight of 464.47 g/mol. Its IUPAC name is 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid.
Molecular Properties
| Compound Name | 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid |
| PubChem CID | 10457147 |
| Molecular Formula | C29H20O6 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(OCc2ccccc2)c2c(c1)C(=O)c1cccc(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C29H20O6/c30-27-21-12-7-13-23(34-16-18-8-3-1-4-9-18)25(21)28(31)26-22(27)14-20(29(32)33)15-24(26)35-17-19-10-5-2-6-11-19/h1-15H,16-17H2,(H,32,33) |
| InChIKey | RHCXWKNSDUXCNX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid?
The IUPAC name of 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid (CID 10457147) is 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid.
What is the SMILES notation for 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid?
The canonical SMILES for 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid is O=C(O)c1cc(OCc2ccccc2)c2c(c1)C(=O)c1cccc(OCc3ccccc3)c1C2=O.
What is the InChIKey of 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid?
The InChIKey is RHCXWKNSDUXCNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20O6/c30-27-21-12-7-13-23(34-16-18-8-3-1-4-9-18)25(21)28(31)26-22(27)14-20(29(32)33)15-24(26)35-17-19-10-5-2-6-11-19/h1-15H,16-17H2,(H,32,33).
What are the key properties of 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid?
9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid has a molecular weight of 464.47 g/mol, XLogP of 5.32, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dioxo-4,5-bis(phenylmethoxy)anthracene-2-carboxylic acid is sourced from PubChem (CID 10457147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).