ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate

C11H15N3O2S — CID 104571473

IUPACethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate
SMILESCCOC(=O)C(C#N)c1nc(C(C)(C)C)ns1
InChIInChI=1S/C11H15N3O2S/c1-5-16-9(15)7(6-12)8-13-10(14-17-8)11(2,3)4/h7H,5H2,1-4H3
InChIKeyQSFXHBZAEDCJOZ-UHFFFAOYSA-N
MW253.33 g/mol
LogP2.01
Rot. Bonds3

About ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate

ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate (PubChem CID 104571473) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate.

Molecular Properties

Compound Nameethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate
PubChem CID104571473
Molecular FormulaC11H15N3O2S
Molecular Weight253.33 g/mol
Exact Mass253.09
IUPAC Nameethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate
SMILESCCOC(=O)C(C#N)c1nc(C(C)(C)C)ns1
InChIInChI=1S/C11H15N3O2S/c1-5-16-9(15)7(6-12)8-13-10(14-17-8)11(2,3)4/h7H,5H2,1-4H3
InChIKeyQSFXHBZAEDCJOZ-UHFFFAOYSA-N
XLogP2.01
TPSA75.87 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.33
LogP ≤ 52.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate?
The IUPAC name of ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate (CID 104571473) is ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate.
What is the SMILES notation for ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate?
The canonical SMILES for ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate is CCOC(=O)C(C#N)c1nc(C(C)(C)C)ns1.
What is the InChIKey of ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate?
The InChIKey is QSFXHBZAEDCJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2S/c1-5-16-9(15)7(6-12)8-13-10(14-17-8)11(2,3)4/h7H,5H2,1-4H3.
What are the key properties of ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate?
ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate has a molecular weight of 253.33 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-2-cyanoacetate is sourced from PubChem (CID 104571473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).