C12H14N4 — CID 104573601
15-methyl-3,6,9,15-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene (PubChem CID 104573601) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 15-methyl-3,6,9,15-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene.
| Compound Name | 15-methyl-3,6,9,15-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 104573601 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 15-methyl-3,6,9,15-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),4,6,8-tetraene |
| SMILES | CN1C2CCC1c1c(nc3cnccn13)C2 |
| InChI | InChI=1S/C12H14N4/c1-15-8-2-3-10(15)12-9(6-8)14-11-7-13-4-5-16(11)12/h4-5,7-8,10H,2-3,6H2,1H3 |
| InChIKey | XJPUUCFOVHDJBU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |