C15H20F6N2O8 — CID 10457413
N-[(3R)-5-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 10457413) has the molecular formula C15H20F6N2O8 and a molecular weight of 470.32 g/mol. Its IUPAC name is N-[(3R)-5-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3R)-5-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10457413 |
| Molecular Formula | C15H20F6N2O8 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | N-[(3R)-5-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1CC(O[C@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)C[C@@H](NC(=O)C(F)(F)F)C1O)C(F)(F)F |
| InChI | InChI=1S/C15H20F6N2O8/c16-14(17,18)12(28)22-5-1-4(30-11-10(27)9(26)7(3-24)31-11)2-6(8(5)25)23-13(29)15(19,20)21/h4-11,24-27H,1-3H2,(H,22,28)(H,23,29)/t4?,5-,6?,7-,8?,9-,10+,11+/m1/s1 |
| InChIKey | DESVAXQLNZMZEH-DBVYZSFOSA-N |
| XLogP | -1.94 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |