C26H30O4S2 — CID 10457447
(2S,3R)-3-(benzenesulfonylmethyl)-8,8-dimethyl-2-(phenylsulfanylmethyl)spiro[4.5]decane-6,10-dione (PubChem CID 10457447) has the molecular formula C26H30O4S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is (2S,3R)-3-(benzenesulfonylmethyl)-8,8-dimethyl-2-(phenylsulfanylmethyl)spiro[4.5]decane-6,10-dione.
| Compound Name | (2S,3R)-3-(benzenesulfonylmethyl)-8,8-dimethyl-2-(phenylsulfanylmethyl)spiro[4.5]decane-6,10-dione |
|---|---|
| PubChem CID | 10457447 |
| Molecular Formula | C26H30O4S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (2S,3R)-3-(benzenesulfonylmethyl)-8,8-dimethyl-2-(phenylsulfanylmethyl)spiro[4.5]decane-6,10-dione |
| SMILES | CC1(C)CC(=O)C2(C[C@H](CSc3ccccc3)[C@H](CS(=O)(=O)c3ccccc3)C2)C(=O)C1 |
| InChI | InChI=1S/C26H30O4S2/c1-25(2)15-23(27)26(24(28)16-25)13-19(17-31-21-9-5-3-6-10-21)20(14-26)18-32(29,30)22-11-7-4-8-12-22/h3-12,19-20H,13-18H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | XUIZYCMVGWPLCI-UXHICEINSA-N |
| XLogP | 5.22 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|