C16H33NO — CID 104575141
1-[(4-tert-butylcyclohexyl)methylamino]-2-methylbutan-2-ol (PubChem CID 104575141) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-[(4-tert-butylcyclohexyl)methylamino]-2-methylbutan-2-ol.
| Compound Name | 1-[(4-tert-butylcyclohexyl)methylamino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 104575141 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 1-[(4-tert-butylcyclohexyl)methylamino]-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)CNCC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H33NO/c1-6-16(5,18)12-17-11-13-7-9-14(10-8-13)15(2,3)4/h13-14,17-18H,6-12H2,1-5H3 |
| InChIKey | POHKVAZQXSYSIV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |