C20H39N — CID 104575232
(1R)-N-[(4-tert-butylcyclohexyl)methyl]-1-cycloheptylethanamine (PubChem CID 104575232) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is (1R)-N-[(4-tert-butylcyclohexyl)methyl]-1-cycloheptylethanamine.
| Compound Name | (1R)-N-[(4-tert-butylcyclohexyl)methyl]-1-cycloheptylethanamine |
|---|---|
| PubChem CID | 104575232 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | (1R)-N-[(4-tert-butylcyclohexyl)methyl]-1-cycloheptylethanamine |
| SMILES | C[C@@H](NCC1CCC(C(C)(C)C)CC1)C1CCCCCC1 |
| InChI | InChI=1S/C20H39N/c1-16(18-9-7-5-6-8-10-18)21-15-17-11-13-19(14-12-17)20(2,3)4/h16-19,21H,5-15H2,1-4H3/t16-,17?,19?/m1/s1 |
| InChIKey | IRQTYJUCUUMWBO-LRYGQEGESA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |