C20H16N4O4S3 — CID 10457525
2-[[4-[(7-oxo-6-phenyl-5-sulfanylidene-7aH-imidazo[1,5-b][1,4,2]dithiazol-2-ylidene)amino]benzoyl]amino]propanoic acid (PubChem CID 10457525) has the molecular formula C20H16N4O4S3 and a molecular weight of 472.57 g/mol. Its IUPAC name is 2-[[4-[(7-oxo-6-phenyl-5-sulfanylidene-7aH-imidazo[1,5-b][1,4,2]dithiazol-2-ylidene)amino]benzoyl]amino]propanoic acid.
| Compound Name | 2-[[4-[(7-oxo-6-phenyl-5-sulfanylidene-7aH-imidazo[1,5-b][1,4,2]dithiazol-2-ylidene)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10457525 |
| Molecular Formula | C20H16N4O4S3 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 2-[[4-[(7-oxo-6-phenyl-5-sulfanylidene-7aH-imidazo[1,5-b][1,4,2]dithiazol-2-ylidene)amino]benzoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)c1ccc(/N=C2/SC3C(=O)N(c4ccccc4)C(=S)N3S2)cc1)C(=O)O |
| InChI | InChI=1S/C20H16N4O4S3/c1-11(18(27)28)21-15(25)12-7-9-13(10-8-12)22-19-30-17-16(26)23(20(29)24(17)31-19)14-5-3-2-4-6-14/h2-11,17H,1H3,(H,21,25)(H,27,28)/b22-19- |
| InChIKey | JQHJCFNVTJLYGQ-QOCHGBHMSA-N |
| XLogP | 3.23 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|