C17H34N2S — CID 104575373
2-(4-tert-butylcyclohexyl)-2-(1,4-thiazepan-4-yl)ethanamine (PubChem CID 104575373) has the molecular formula C17H34N2S and a molecular weight of 298.54 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexyl)-2-(1,4-thiazepan-4-yl)ethanamine.
| Compound Name | 2-(4-tert-butylcyclohexyl)-2-(1,4-thiazepan-4-yl)ethanamine |
|---|---|
| PubChem CID | 104575373 |
| Molecular Formula | C17H34N2S |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-(4-tert-butylcyclohexyl)-2-(1,4-thiazepan-4-yl)ethanamine |
| SMILES | CC(C)(C)C1CCC(C(CN)N2CCCSCC2)CC1 |
| InChI | InChI=1S/C17H34N2S/c1-17(2,3)15-7-5-14(6-8-15)16(13-18)19-9-4-11-20-12-10-19/h14-16H,4-13,18H2,1-3H3 |
| InChIKey | BEXKLLGIBPPTLP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |