C21H31NO4 — CID 104575616
3-(4-tert-butylcyclohexyl)-3-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 104575616) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 3-(4-tert-butylcyclohexyl)-3-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(4-tert-butylcyclohexyl)-3-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 104575616 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 3-(4-tert-butylcyclohexyl)-3-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(C)(C)C1CCC(C(CC(=O)O)NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31NO4/c1-21(2,3)17-11-9-16(10-12-17)18(13-19(23)24)22-20(25)26-14-15-7-5-4-6-8-15/h4-8,16-18H,9-14H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | YLNJRTMJDFJEKX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |