C15H26O3 — CID 104575992
2-(4-tert-butylcyclohexyl)oxolane-3-carboxylic acid (PubChem CID 104575992) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexyl)oxolane-3-carboxylic acid.
| Compound Name | 2-(4-tert-butylcyclohexyl)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 104575992 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-(4-tert-butylcyclohexyl)oxolane-3-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(C2OCCC2C(=O)O)CC1 |
| InChI | InChI=1S/C15H26O3/c1-15(2,3)11-6-4-10(5-7-11)13-12(14(16)17)8-9-18-13/h10-13H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | NJPXEIXGCZUTPS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |