C23H30N4O5S — CID 10457618
(5S)-5-ethyl-5-[[4-[(2-methylquinolin-4-yl)methoxymethyl]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 10457618) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is (5S)-5-ethyl-5-[[4-[(2-methylquinolin-4-yl)methoxymethyl]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-5-[[4-[(2-methylquinolin-4-yl)methoxymethyl]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10457618 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (5S)-5-ethyl-5-[[4-[(2-methylquinolin-4-yl)methoxymethyl]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | CC[C@]1(CS(=O)(=O)N2CCC(COCc3cc(C)nc4ccccc34)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H30N4O5S/c1-3-23(21(28)25-22(29)26-23)15-33(30,31)27-10-8-17(9-11-27)13-32-14-18-12-16(2)24-20-7-5-4-6-19(18)20/h4-7,12,17H,3,8-11,13-15H2,1-2H3,(H2,25,26,28,29)/t23-/m1/s1 |
| InChIKey | MXHWTPXELCYBKJ-HSZRJFAPSA-N |
| XLogP | 2.09 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|