C14H14BrCl2NO3 — CID 104576281
2-[(4-bromo-2,3-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 104576281) has the molecular formula C14H14BrCl2NO3 and a molecular weight of 395.08 g/mol. Its IUPAC name is 2-[(4-bromo-2,3-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(4-bromo-2,3-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104576281 |
| Molecular Formula | C14H14BrCl2NO3 |
| Molecular Weight | 395.08 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 2-[(4-bromo-2,3-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H14BrCl2NO3/c15-9-5-6-10(12(17)11(9)16)18-13(19)7-3-1-2-4-8(7)14(20)21/h5-8H,1-4H2,(H,18,19)(H,20,21) |
| InChIKey | CUIXOJTXTKJELK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.08 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|