C16H12F3IN4S — CID 10457673
5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-ethyl-1,3,4-thiadiazol-2-amine (PubChem CID 10457673) has the molecular formula C16H12F3IN4S and a molecular weight of 476.27 g/mol. Its IUPAC name is 5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-ethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-ethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 10457673 |
| Molecular Formula | C16H12F3IN4S |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | 5-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-ethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(-c2ccc(F)c(F)c2Nc2ccc(I)cc2F)s1 |
| InChI | InChI=1S/C16H12F3IN4S/c1-2-21-16-24-23-15(25-16)9-4-5-10(17)13(19)14(9)22-12-6-3-8(20)7-11(12)18/h3-7,22H,2H2,1H3,(H,21,24) |
| InChIKey | BVIQSWRTNXBZHE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|