C7H13N3OS — CID 104577034
N-(2-propan-2-yloxyethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 104577034) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is N-(2-propan-2-yloxyethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-propan-2-yloxyethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 104577034 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | N-(2-propan-2-yloxyethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)OCCNc1ncns1 |
| InChI | InChI=1S/C7H13N3OS/c1-6(2)11-4-3-8-7-9-5-10-12-7/h5-6H,3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | BDFZUKZRSFJWMK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|