C15H28N2O4 — CID 104578291
methyl 2-[[1-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]butanoate (PubChem CID 104578291) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 2-[[1-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]butanoate.
| Compound Name | methyl 2-[[1-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]butanoate |
|---|---|
| PubChem CID | 104578291 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | methyl 2-[[1-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]butanoate |
| SMILES | CCC(NC(CNC(=O)OC(C)(C)C)C1CC1)C(=O)OC |
| InChI | InChI=1S/C15H28N2O4/c1-6-11(13(18)20-5)17-12(10-7-8-10)9-16-14(19)21-15(2,3)4/h10-12,17H,6-9H2,1-5H3,(H,16,19) |
| InChIKey | BVRPLOUUOKWTAD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |