C14H19BrFNO2 — CID 104578657
methyl 2-[(2-bromo-4-fluorophenyl)methylamino]-3-methylpentanoate (PubChem CID 104578657) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is methyl 2-[(2-bromo-4-fluorophenyl)methylamino]-3-methylpentanoate.
| Compound Name | methyl 2-[(2-bromo-4-fluorophenyl)methylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 104578657 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | methyl 2-[(2-bromo-4-fluorophenyl)methylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NCc1ccc(F)cc1Br)C(=O)OC |
| InChI | InChI=1S/C14H19BrFNO2/c1-4-9(2)13(14(18)19-3)17-8-10-5-6-11(16)7-12(10)15/h5-7,9,13,17H,4,8H2,1-3H3 |
| InChIKey | QZZFAYUCURFJPC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |