About 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide
3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide (PubChem CID 104580423) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide.
Molecular Properties
| Compound Name | 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide |
| PubChem CID | 104580423 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NCC1CCOCO1 |
| InChI | InChI=1S/C10H20N2O3/c1-10(2,5-9(11)13)12-6-8-3-4-14-7-15-8/h8,12H,3-7H2,1-2H3,(H2,11,13) |
| InChIKey | SZXHTZKFLXQSTH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide?
The IUPAC name of 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide (CID 104580423) is 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide.
What is the SMILES notation for 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide?
The canonical SMILES for 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide is CC(C)(CC(N)=O)NCC1CCOCO1.
What is the InChIKey of 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide?
The InChIKey is SZXHTZKFLXQSTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-10(2,5-9(11)13)12-6-8-3-4-14-7-15-8/h8,12H,3-7H2,1-2H3,(H2,11,13).
What are the key properties of 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide?
3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide has a molecular weight of 216.28 g/mol, XLogP of -0.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxan-4-ylmethylamino)-3-methylbutanamide is sourced from PubChem (CID 104580423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).