C13H13N3O2S — CID 104580537
1-(4-acetylphenyl)-3-(1,3-thiazol-5-ylmethyl)urea (PubChem CID 104580537) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-(1,3-thiazol-5-ylmethyl)urea.
| Compound Name | 1-(4-acetylphenyl)-3-(1,3-thiazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 104580537 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(4-acetylphenyl)-3-(1,3-thiazol-5-ylmethyl)urea |
| SMILES | CC(=O)c1ccc(NC(=O)NCc2cncs2)cc1 |
| InChI | InChI=1S/C13H13N3O2S/c1-9(17)10-2-4-11(5-3-10)16-13(18)15-7-12-6-14-8-19-12/h2-6,8H,7H2,1H3,(H2,15,16,18) |
| InChIKey | RIVJVHKCPKATTB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |