C8H14F3N3O2 — CID 104581253
3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanamide (PubChem CID 104581253) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanamide.
| Compound Name | 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 104581253 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanamide |
| SMILES | CC(C)C(NC(=O)NCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C8H14F3N3O2/c1-4(2)5(6(12)15)14-7(16)13-3-8(9,10)11/h4-5H,3H2,1-2H3,(H2,12,15)(H2,13,14,16) |
| InChIKey | NATPOZDEBQPNSH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |