C13H22F3N — CID 104581723
N-hex-5-en-2-yl-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 104581723) has the molecular formula C13H22F3N and a molecular weight of 249.32 g/mol. Its IUPAC name is N-hex-5-en-2-yl-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-hex-5-en-2-yl-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 104581723 |
| Molecular Formula | C13H22F3N |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-hex-5-en-2-yl-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | C=CCCC(C)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3N/c1-3-4-5-10(2)17-12-8-6-11(7-9-12)13(14,15)16/h3,10-12,17H,1,4-9H2,2H3 |
| InChIKey | OQTKKLBNHGSVAM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|