C11H13F4NO2 — CID 104581913
4-fluoro-2-[1-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]phenol (PubChem CID 104581913) has the molecular formula C11H13F4NO2 and a molecular weight of 267.22 g/mol. Its IUPAC name is 4-fluoro-2-[1-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]phenol.
| Compound Name | 4-fluoro-2-[1-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 104581913 |
| Molecular Formula | C11H13F4NO2 |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-fluoro-2-[1-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]phenol |
| SMILES | CC(NCC(O)C(F)(F)F)c1cc(F)ccc1O |
| InChI | InChI=1S/C11H13F4NO2/c1-6(16-5-10(18)11(13,14)15)8-4-7(12)2-3-9(8)17/h2-4,6,10,16-18H,5H2,1H3 |
| InChIKey | IOPOSMAQGAYLOE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|