C13H17F2N — CID 104581930
N-[(3,4-difluorophenyl)methyl]hex-5-en-2-amine (PubChem CID 104581930) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]hex-5-en-2-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 104581930 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]hex-5-en-2-amine |
| SMILES | C=CCCC(C)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2N/c1-3-4-5-10(2)16-9-11-6-7-12(14)13(15)8-11/h3,6-8,10,16H,1,4-5,9H2,2H3 |
| InChIKey | WYKIPSVPKPLFIO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|