C10H20N2O — CID 104581947
3-(hex-5-en-2-ylamino)-N-methylpropanamide (PubChem CID 104581947) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-(hex-5-en-2-ylamino)-N-methylpropanamide.
| Compound Name | 3-(hex-5-en-2-ylamino)-N-methylpropanamide |
|---|---|
| PubChem CID | 104581947 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-(hex-5-en-2-ylamino)-N-methylpropanamide |
| SMILES | C=CCCC(C)NCCC(=O)NC |
| InChI | InChI=1S/C10H20N2O/c1-4-5-6-9(2)12-8-7-10(13)11-3/h4,9,12H,1,5-8H2,2-3H3,(H,11,13) |
| InChIKey | RAOXUUKKZOVCPI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|