C16H28N2O2 — CID 104582210
2-[1-[2-[butan-2-yl(methyl)amino]ethylamino]ethyl]-5-methoxyphenol (PubChem CID 104582210) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[1-[2-[butan-2-yl(methyl)amino]ethylamino]ethyl]-5-methoxyphenol.
| Compound Name | 2-[1-[2-[butan-2-yl(methyl)amino]ethylamino]ethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 104582210 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-[1-[2-[butan-2-yl(methyl)amino]ethylamino]ethyl]-5-methoxyphenol |
| SMILES | CCC(C)N(C)CCNC(C)c1ccc(OC)cc1O |
| InChI | InChI=1S/C16H28N2O2/c1-6-12(2)18(4)10-9-17-13(3)15-8-7-14(20-5)11-16(15)19/h7-8,11-13,17,19H,6,9-10H2,1-5H3 |
| InChIKey | BKIKJJDHTBPUIK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|