C16H27NO3 — CID 104582540
2-[1-[(2-hydroxy-4,4-dimethylpentyl)amino]ethyl]-5-methoxyphenol (PubChem CID 104582540) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[1-[(2-hydroxy-4,4-dimethylpentyl)amino]ethyl]-5-methoxyphenol.
| Compound Name | 2-[1-[(2-hydroxy-4,4-dimethylpentyl)amino]ethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 104582540 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-[1-[(2-hydroxy-4,4-dimethylpentyl)amino]ethyl]-5-methoxyphenol |
| SMILES | COc1ccc(C(C)NCC(O)CC(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C16H27NO3/c1-11(17-10-12(18)9-16(2,3)4)14-7-6-13(20-5)8-15(14)19/h6-8,11-12,17-19H,9-10H2,1-5H3 |
| InChIKey | JBGRMQDJDPNBFS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|