C31H39NO4 — CID 10458260
2-[(1S,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-(2-phenylethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]propan-2-ol (PubChem CID 10458260) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[(1S,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-(2-phenylethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]propan-2-ol.
| Compound Name | 2-[(1S,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-(2-phenylethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]propan-2-ol |
|---|---|
| PubChem CID | 10458260 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 2-[(1S,2S,6R,14R,15R,16S)-11,15-dimethoxy-5-(2-phenylethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]propan-2-ol |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@H]4C(C)(C)O)[C@@H](C2)N(CCc2ccccc2)CC[C@]315 |
| InChI | InChI=1S/C31H39NO4/c1-28(2,33)23-19-29-13-14-31(23,35-4)27-30(29)15-17-32(16-12-20-8-6-5-7-9-20)24(29)18-21-10-11-22(34-3)26(36-27)25(21)30/h5-11,23-24,27,33H,12-19H2,1-4H3/t23-,24+,27+,29+,30-,31+/m0/s1 |
| InChIKey | CYVDFPGVXDHFCX-NXBWDZBBSA-N |
| XLogP | 4.52 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |