C12H21N3O — CID 104583094
N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine (PubChem CID 104583094) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine.
| Compound Name | N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 104583094 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine |
| SMILES | C=CCCC(C)NCCc1noc(CC)n1 |
| InChI | InChI=1S/C12H21N3O/c1-4-6-7-10(3)13-9-8-11-14-12(5-2)16-15-11/h4,10,13H,1,5-9H2,2-3H3 |
| InChIKey | INBOTFKDYSWQPR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|