C32H33N3O2 — CID 10458344
4-[7,7,10,10-tetramethyl-1-(pyridin-3-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl]benzoic acid (PubChem CID 10458344) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 4-[7,7,10,10-tetramethyl-1-(pyridin-3-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl]benzoic acid.
| Compound Name | 4-[7,7,10,10-tetramethyl-1-(pyridin-3-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 10458344 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 4-[7,7,10,10-tetramethyl-1-(pyridin-3-ylmethyl)-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)nn(Cc2cccnc2)c1-3 |
| InChI | InChI=1S/C32H33N3O2/c1-31(2)13-14-32(3,4)27-17-25-23(16-26(27)31)11-12-24-28(21-7-9-22(10-8-21)30(36)37)34-35(29(24)25)19-20-6-5-15-33-18-20/h5-10,15-18H,11-14,19H2,1-4H3,(H,36,37) |
| InChIKey | IVFXSJDULWTLKR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |