C11H19N3 — CID 104583972
N-hex-5-en-2-yl-1,5-dimethylpyrazol-3-amine (PubChem CID 104583972) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-hex-5-en-2-yl-1,5-dimethylpyrazol-3-amine.
| Compound Name | N-hex-5-en-2-yl-1,5-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 104583972 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-hex-5-en-2-yl-1,5-dimethylpyrazol-3-amine |
| SMILES | C=CCCC(C)Nc1cc(C)n(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-5-6-7-9(2)12-11-8-10(3)14(4)13-11/h5,8-9H,1,6-7H2,2-4H3,(H,12,13) |
| InChIKey | KZXGFHPWMRDQCM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|