C14H19NO — CID 104584497
N-(3-methoxycyclobutyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 104584497) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(3-methoxycyclobutyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(3-methoxycyclobutyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 104584497 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-(3-methoxycyclobutyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | COC1CC(NC2Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C14H19NO/c1-16-14-8-13(9-14)15-12-6-10-4-2-3-5-11(10)7-12/h2-5,12-15H,6-9H2,1H3 |
| InChIKey | PQLKAKYGKZKDIT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |