C14H20ClNO2 — CID 104585198
N-[1-(2-chlorophenyl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 104585198) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 104585198 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC(NC1COC(C)(C)OC1)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO2/c1-10(12-6-4-5-7-13(12)15)16-11-8-17-14(2,3)18-9-11/h4-7,10-11,16H,8-9H2,1-3H3 |
| InChIKey | RHPKECLIAZYYKF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |