About N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine
N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 104585340) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine |
| PubChem CID | 104585340 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(NC2CCCCC2)CO1 |
| InChI | InChI=1S/C12H23NO2/c1-12(2)14-8-11(9-15-12)13-10-6-4-3-5-7-10/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | ZHWWXPFPNLHSMY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine?
The IUPAC name of N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine (CID 104585340) is N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine.
What is the SMILES notation for N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine?
The canonical SMILES for N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine is CC1(C)OCC(NC2CCCCC2)CO1.
What is the InChIKey of N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine?
The InChIKey is ZHWWXPFPNLHSMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-12(2)14-8-11(9-15-12)13-10-6-4-3-5-7-10/h10-11,13H,3-9H2,1-2H3.
What are the key properties of N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine?
N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine has a molecular weight of 213.32 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2,2-dimethyl-1,3-dioxan-5-amine is sourced from PubChem (CID 104585340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).