C14H14FNO3 — CID 104585887
methyl 5-[[(3-fluorophenyl)methylamino]methyl]furan-3-carboxylate (PubChem CID 104585887) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is methyl 5-[[(3-fluorophenyl)methylamino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[(3-fluorophenyl)methylamino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104585887 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl 5-[[(3-fluorophenyl)methylamino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C14H14FNO3/c1-18-14(17)11-6-13(19-9-11)8-16-7-10-3-2-4-12(15)5-10/h2-6,9,16H,7-8H2,1H3 |
| InChIKey | OWJCEZQKRLBXIY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |