C19H25F4N3O6S — CID 10458603
N-hydroxy-4-[4-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 10458603) has the molecular formula C19H25F4N3O6S and a molecular weight of 499.48 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10458603 |
| Molecular Formula | C19H25F4N3O6S |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-hydroxy-4-[4-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(OCC(F)(F)C(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H25F4N3O6S/c20-16(21)19(22,23)12-32-14-1-2-15(24-11-14)13-3-7-26(8-4-13)33(29,30)18(17(27)25-28)5-9-31-10-6-18/h1-2,11,13,16,28H,3-10,12H2,(H,25,27) |
| InChIKey | JSFYENAUWVOFCX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|