About 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide
5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide (PubChem CID 10458713) has the molecular formula C24H27IN2O2
and a molecular weight of 502.40 g/mol. Its IUPAC name is 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide.
Molecular Properties
| Compound Name | 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide |
| PubChem CID | 10458713 |
| Molecular Formula | C24H27IN2O2 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide |
| SMILES | CC(C)c1n(CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)cc[n+]1C.[I-] |
| InChI | InChI=1S/C24H27N2O2.HI/c1-18(2)22-25(3)14-15-26(22)17-21-16-24(23(27)28-21,19-10-6-4-7-11-19)20-12-8-5-9-13-20;/h4-15,18,21H,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZXLCSRRQXMJXNH-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide?
The IUPAC name of 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide (CID 10458713) is 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide.
What is the SMILES notation for 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide?
The canonical SMILES for 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide is CC(C)c1n(CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)cc[n+]1C.[I-].
What is the InChIKey of 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide?
The InChIKey is ZXLCSRRQXMJXNH-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H27N2O2.HI/c1-18(2)22-25(3)14-15-26(22)17-21-16-24(23(27)28-21,19-10-6-4-7-11-19)20-12-8-5-9-13-20;/h4-15,18,21H,16-17H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide?
5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide has a molecular weight of 502.40 g/mol, XLogP of 0.74, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one iodide is sourced from PubChem (CID 10458713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).