C14H23NO2 — CID 104588290
N-[(2-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine (PubChem CID 104588290) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 104588290 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine |
| SMILES | CCOc1ccccc1CNCCOC(C)C |
| InChI | InChI=1S/C14H23NO2/c1-4-16-14-8-6-5-7-13(14)11-15-9-10-17-12(2)3/h5-8,12,15H,4,9-11H2,1-3H3 |
| InChIKey | VZCXSHZOLAGNGQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|