C12H18BrNO2 — CID 104588373
4-bromo-2-[(2-propan-2-yloxyethylamino)methyl]phenol (PubChem CID 104588373) has the molecular formula C12H18BrNO2 and a molecular weight of 288.18 g/mol. Its IUPAC name is 4-bromo-2-[(2-propan-2-yloxyethylamino)methyl]phenol.
| Compound Name | 4-bromo-2-[(2-propan-2-yloxyethylamino)methyl]phenol |
|---|---|
| PubChem CID | 104588373 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-bromo-2-[(2-propan-2-yloxyethylamino)methyl]phenol |
| SMILES | CC(C)OCCNCc1cc(Br)ccc1O |
| InChI | InChI=1S/C12H18BrNO2/c1-9(2)16-6-5-14-8-10-7-11(13)3-4-12(10)15/h3-4,7,9,14-15H,5-6,8H2,1-2H3 |
| InChIKey | FZHUQDCTZQUIKG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|