C20H24F6O8 — CID 10458850
[(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-4,4,4-trifluorobut-2-enoyl]oxyethyl] (E)-4,4,4-trifluorobut-2-enoate (PubChem CID 10458850) has the molecular formula C20H24F6O8 and a molecular weight of 506.39 g/mol. Its IUPAC name is [(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-4,4,4-trifluorobut-2-enoyl]oxyethyl] (E)-4,4,4-trifluorobut-2-enoate.
| Compound Name | [(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-4,4,4-trifluorobut-2-enoyl]oxyethyl] (E)-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 10458850 |
| Molecular Formula | C20H24F6O8 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [(1R,2R)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-4,4,4-trifluorobut-2-enoyl]oxyethyl] (E)-4,4,4-trifluorobut-2-enoate |
| SMILES | CC1(C)OC[C@H]([C@@H](OC(=O)/C=C/C(F)(F)F)[C@H](OC(=O)/C=C/C(F)(F)F)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C20H24F6O8/c1-17(2)29-9-11(33-17)15(31-13(27)5-7-19(21,22)23)16(12-10-30-18(3,4)34-12)32-14(28)6-8-20(24,25)26/h5-8,11-12,15-16H,9-10H2,1-4H3/b7-5+,8-6+/t11-,12-,15-,16-/m1/s1 |
| InChIKey | IVTXKYHSUJUVPP-VTOKMMJCSA-N |
| XLogP | 3.35 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|