C31H42O4Si — CID 10458877
2-[(3'S,3'aS)-3'-[tert-butyl(diphenyl)silyl]oxy-3'a-methylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-yl]propan-2-ol (PubChem CID 10458877) has the molecular formula C31H42O4Si and a molecular weight of 506.76 g/mol. Its IUPAC name is 2-[(3'S,3'aS)-3'-[tert-butyl(diphenyl)silyl]oxy-3'a-methylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-yl]propan-2-ol.
| Compound Name | 2-[(3'S,3'aS)-3'-[tert-butyl(diphenyl)silyl]oxy-3'a-methylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-yl]propan-2-ol |
|---|---|
| PubChem CID | 10458877 |
| Molecular Formula | C31H42O4Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[(3'S,3'aS)-3'-[tert-butyl(diphenyl)silyl]oxy-3'a-methylspiro[1,3-dioxolane-2,6'-3,4,5,7-tetrahydro-2H-indene]-1'-yl]propan-2-ol |
| SMILES | CC(C)(O)C1=C2CC3(CC[C@]2(C)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1)OCCO3 |
| InChI | InChI=1S/C31H42O4Si/c1-28(2,3)36(23-13-9-7-10-14-23,24-15-11-8-12-16-24)35-27-21-25(29(4,5)32)26-22-31(33-19-20-34-31)18-17-30(26,27)6/h7-16,27,32H,17-22H2,1-6H3/t27-,30-/m0/s1 |
| InChIKey | XRNFSTGITOUSNK-FIBWVYCGSA-N |
| XLogP | 5.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|