C10H8BrCl2F3N2O — CID 104589231
2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 104589231) has the molecular formula C10H8BrCl2F3N2O and a molecular weight of 379.99 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 104589231 |
| Molecular Formula | C10H8BrCl2F3N2O |
| Molecular Weight | 379.99 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | 2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNc1ccc(Br)c(Cl)c1Cl)NCC(F)(F)F |
| InChI | InChI=1S/C10H8BrCl2F3N2O/c11-5-1-2-6(9(13)8(5)12)17-3-7(19)18-4-10(14,15)16/h1-2,17H,3-4H2,(H,18,19) |
| InChIKey | FQXFTBCLRLHRIR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.99 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|